C31H34Cl2N4O3 — CID 44532234
3,5-dichloro-N-[4-[4-(9-methoxy-1,3,4,6,11,11a-hexahydropyrazino[1,2-b]isoquinolin-2-yl)butylcarbamoyl]phenyl]benzamide (PubChem CID 44532234) has the molecular formula C31H34Cl2N4O3 and a molecular weight of 581.54 g/mol. Its IUPAC name is 3,5-dichloro-N-[4-[4-(9-methoxy-1,3,4,6,11,11a-hexahydropyrazino[1,2-b]isoquinolin-2-yl)butylcarbamoyl]phenyl]benzamide.
| Compound Name | 3,5-dichloro-N-[4-[4-(9-methoxy-1,3,4,6,11,11a-hexahydropyrazino[1,2-b]isoquinolin-2-yl)butylcarbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 44532234 |
| Molecular Formula | C31H34Cl2N4O3 |
| Molecular Weight | 581.54 g/mol |
| Exact Mass | 580.20 |
| IUPAC Name | 3,5-dichloro-N-[4-[4-(9-methoxy-1,3,4,6,11,11a-hexahydropyrazino[1,2-b]isoquinolin-2-yl)butylcarbamoyl]phenyl]benzamide |
| SMILES | COc1ccc2c(c1)CC1CN(CCCCNC(=O)c3ccc(NC(=O)c4cc(Cl)cc(Cl)c4)cc3)CCN1C2 |
| InChI | InChI=1S/C31H34Cl2N4O3/c1-40-29-9-6-22-19-37-13-12-36(20-28(37)16-23(22)17-29)11-3-2-10-34-30(38)21-4-7-27(8-5-21)35-31(39)24-14-25(32)18-26(33)15-24/h4-9,14-15,17-18,28H,2-3,10-13,16,19-20H2,1H3,(H,34,38)(H,35,39) |
| InChIKey | HMNBYPOENJHEBF-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.54 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|