C30H30ClN5O3S — CID 44532254
6-[3-[(2-methylsulfonylethylamino)methyl]phenyl]-N-(4-phenylmethoxyphenyl)pyrido[3,4-d]pyrimidin-4-amine;hydrochloride (PubChem CID 44532254) has the molecular formula C30H30ClN5O3S and a molecular weight of 576.12 g/mol. Its IUPAC name is 6-[3-[(2-methylsulfonylethylamino)methyl]phenyl]-N-(4-phenylmethoxyphenyl)pyrido[3,4-d]pyrimidin-4-amine;hydrochloride.
| Compound Name | 6-[3-[(2-methylsulfonylethylamino)methyl]phenyl]-N-(4-phenylmethoxyphenyl)pyrido[3,4-d]pyrimidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 44532254 |
| Molecular Formula | C30H30ClN5O3S |
| Molecular Weight | 576.12 g/mol |
| Exact Mass | 575.18 |
| IUPAC Name | 6-[3-[(2-methylsulfonylethylamino)methyl]phenyl]-N-(4-phenylmethoxyphenyl)pyrido[3,4-d]pyrimidin-4-amine;hydrochloride |
| SMILES | CS(=O)(=O)CCNCc1cccc(-c2cc3c(Nc4ccc(OCc5ccccc5)cc4)ncnc3cn2)c1.Cl |
| InChI | InChI=1S/C30H29N5O3S.ClH/c1-39(36,37)15-14-31-18-23-8-5-9-24(16-23)28-17-27-29(19-32-28)33-21-34-30(27)35-25-10-12-26(13-11-25)38-20-22-6-3-2-4-7-22;/h2-13,16-17,19,21,31H,14-15,18,20H2,1H3,(H,33,34,35);1H |
| InChIKey | QKONASNSDPZVBH-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.12 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|