About 2,6-bis(3,4-dimethoxyphenyl)pyrazine;hydrochloride
2,6-bis(3,4-dimethoxyphenyl)pyrazine;hydrochloride (PubChem CID 44532263) has the molecular formula C20H21ClN2O4
and a molecular weight of 388.85 g/mol. Its IUPAC name is 2,6-bis(3,4-dimethoxyphenyl)pyrazine;hydrochloride.
Molecular Properties
| Compound Name | 2,6-bis(3,4-dimethoxyphenyl)pyrazine;hydrochloride |
| PubChem CID | 44532263 |
| Molecular Formula | C20H21ClN2O4 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 2,6-bis(3,4-dimethoxyphenyl)pyrazine;hydrochloride |
| SMILES | COc1ccc(-c2cncc(-c3ccc(OC)c(OC)c3)n2)cc1OC.Cl |
| InChI | InChI=1S/C20H20N2O4.ClH/c1-23-17-7-5-13(9-19(17)25-3)15-11-21-12-16(22-15)14-6-8-18(24-2)20(10-14)26-4;/h5-12H,1-4H3;1H |
| InChIKey | FMNKUGZMTRNFNX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2,6-bis(3,4-dimethoxyphenyl)pyrazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis(3,4-dimethoxyphenyl)pyrazine;hydrochloride?
The IUPAC name of 2,6-bis(3,4-dimethoxyphenyl)pyrazine;hydrochloride (CID 44532263) is 2,6-bis(3,4-dimethoxyphenyl)pyrazine;hydrochloride.
What is the SMILES notation for 2,6-bis(3,4-dimethoxyphenyl)pyrazine;hydrochloride?
The canonical SMILES for 2,6-bis(3,4-dimethoxyphenyl)pyrazine;hydrochloride is COc1ccc(-c2cncc(-c3ccc(OC)c(OC)c3)n2)cc1OC.Cl.
What is the InChIKey of 2,6-bis(3,4-dimethoxyphenyl)pyrazine;hydrochloride?
The InChIKey is FMNKUGZMTRNFNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O4.ClH/c1-23-17-7-5-13(9-19(17)25-3)15-11-21-12-16(22-15)14-6-8-18(24-2)20(10-14)26-4;/h5-12H,1-4H3;1H.
What are the key properties of 2,6-bis(3,4-dimethoxyphenyl)pyrazine;hydrochloride?
2,6-bis(3,4-dimethoxyphenyl)pyrazine;hydrochloride has a molecular weight of 388.85 g/mol, XLogP of 4.27, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis(3,4-dimethoxyphenyl)pyrazine;hydrochloride is sourced from PubChem (CID 44532263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).