C28H24N4 — CID 44532265
(1R,2S,3S,4S,9R,10R,11R,12S)-5,8-dipyridin-2-yl-6,7-diazahexacyclo[10.6.1.13,10.02,11.04,9.013,18]icosa-5,7,13,15,17-pentaene (PubChem CID 44532265) has the molecular formula C28H24N4 and a molecular weight of 416.53 g/mol. Its IUPAC name is (1R,2S,3S,4S,9R,10R,11R,12S)-5,8-dipyridin-2-yl-6,7-diazahexacyclo[10.6.1.13,10.02,11.04,9.013,18]icosa-5,7,13,15,17-pentaene.
| Compound Name | (1R,2S,3S,4S,9R,10R,11R,12S)-5,8-dipyridin-2-yl-6,7-diazahexacyclo[10.6.1.13,10.02,11.04,9.013,18]icosa-5,7,13,15,17-pentaene |
|---|---|
| PubChem CID | 44532265 |
| Molecular Formula | C28H24N4 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | (1R,2S,3S,4S,9R,10R,11R,12S)-5,8-dipyridin-2-yl-6,7-diazahexacyclo[10.6.1.13,10.02,11.04,9.013,18]icosa-5,7,13,15,17-pentaene |
| SMILES | c1ccc(C2=NN=C(c3ccccn3)[C@H]3[C@H]4C[C@@H]([C@@H]23)[C@@H]2[C@H]4[C@H]3C[C@@H]2c2ccccc23)nc1 |
| InChI | InChI=1S/C28H24N4/c1-2-8-16-15(7-1)17-13-18(16)24-20-14-19(23(17)24)25-26(20)28(22-10-4-6-12-30-22)32-31-27(25)21-9-3-5-11-29-21/h1-12,17-20,23-26H,13-14H2/t17-,18+,19-,20+,23-,24+,25-,26+ |
| InChIKey | QAEQEAQDVFBXJR-SAYTYDHWSA-N |
| XLogP | 5.08 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|