C32H40ClN5O3 — CID 44532310
4-[(4-chlorobenzoyl)amino]-N-[4-[4-[4-[2-(dimethylamino)ethoxy]phenyl]piperazin-1-yl]butyl]benzamide (PubChem CID 44532310) has the molecular formula C32H40ClN5O3 and a molecular weight of 578.16 g/mol. Its IUPAC name is 4-[(4-chlorobenzoyl)amino]-N-[4-[4-[4-[2-(dimethylamino)ethoxy]phenyl]piperazin-1-yl]butyl]benzamide.
| Compound Name | 4-[(4-chlorobenzoyl)amino]-N-[4-[4-[4-[2-(dimethylamino)ethoxy]phenyl]piperazin-1-yl]butyl]benzamide |
|---|---|
| PubChem CID | 44532310 |
| Molecular Formula | C32H40ClN5O3 |
| Molecular Weight | 578.16 g/mol |
| Exact Mass | 577.28 |
| IUPAC Name | 4-[(4-chlorobenzoyl)amino]-N-[4-[4-[4-[2-(dimethylamino)ethoxy]phenyl]piperazin-1-yl]butyl]benzamide |
| SMILES | CN(C)CCOc1ccc(N2CCN(CCCCNC(=O)c3ccc(NC(=O)c4ccc(Cl)cc4)cc3)CC2)cc1 |
| InChI | InChI=1S/C32H40ClN5O3/c1-36(2)23-24-41-30-15-13-29(14-16-30)38-21-19-37(20-22-38)18-4-3-17-34-31(39)25-7-11-28(12-8-25)35-32(40)26-5-9-27(33)10-6-26/h5-16H,3-4,17-24H2,1-2H3,(H,34,39)(H,35,40) |
| InChIKey | ZDIGQBZZMPABAT-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.16 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|