C37H41ClN4O3 — CID 44532353
4-[(4-chlorobenzoyl)amino]-N-[4-[4-[2,5-dimethyl-4-(pyridin-3-ylmethoxy)phenyl]piperidin-1-yl]butyl]benzamide (PubChem CID 44532353) has the molecular formula C37H41ClN4O3 and a molecular weight of 625.21 g/mol. Its IUPAC name is 4-[(4-chlorobenzoyl)amino]-N-[4-[4-[2,5-dimethyl-4-(pyridin-3-ylmethoxy)phenyl]piperidin-1-yl]butyl]benzamide.
| Compound Name | 4-[(4-chlorobenzoyl)amino]-N-[4-[4-[2,5-dimethyl-4-(pyridin-3-ylmethoxy)phenyl]piperidin-1-yl]butyl]benzamide |
|---|---|
| PubChem CID | 44532353 |
| Molecular Formula | C37H41ClN4O3 |
| Molecular Weight | 625.21 g/mol |
| Exact Mass | 624.29 |
| IUPAC Name | 4-[(4-chlorobenzoyl)amino]-N-[4-[4-[2,5-dimethyl-4-(pyridin-3-ylmethoxy)phenyl]piperidin-1-yl]butyl]benzamide |
| SMILES | Cc1cc(C2CCN(CCCCNC(=O)c3ccc(NC(=O)c4ccc(Cl)cc4)cc3)CC2)c(C)cc1OCc1cccnc1 |
| InChI | InChI=1S/C37H41ClN4O3/c1-26-23-35(45-25-28-6-5-17-39-24-28)27(2)22-34(26)29-15-20-42(21-16-29)19-4-3-18-40-36(43)30-9-13-33(14-10-30)41-37(44)31-7-11-32(38)12-8-31/h5-14,17,22-24,29H,3-4,15-16,18-21,25H2,1-2H3,(H,40,43)(H,41,44) |
| InChIKey | DHZFWMLIJXJIIT-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.21 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|