About ethyl 3-[[(E)-N'-[4-methyl-6-(2-phenylethylamino)pyrimidin-2-yl]carbamimidoyl]amino]benzoate
ethyl 3-[[(E)-N'-[4-methyl-6-(2-phenylethylamino)pyrimidin-2-yl]carbamimidoyl]amino]benzoate (PubChem CID 44532427) has the molecular formula C23H26N6O2
and a molecular weight of 418.50 g/mol. Its IUPAC name is ethyl 3-[[(E)-N'-[4-methyl-6-(2-phenylethylamino)pyrimidin-2-yl]carbamimidoyl]amino]benzoate.
Molecular Properties
| Compound Name | ethyl 3-[[(E)-N'-[4-methyl-6-(2-phenylethylamino)pyrimidin-2-yl]carbamimidoyl]amino]benzoate |
| PubChem CID | 44532427 |
| Molecular Formula | C23H26N6O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | ethyl 3-[[(E)-N'-[4-methyl-6-(2-phenylethylamino)pyrimidin-2-yl]carbamimidoyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(N/C(N)=N/c2nc(C)cc(NCCc3ccccc3)n2)c1 |
| InChI | InChI=1S/C23H26N6O2/c1-3-31-21(30)18-10-7-11-19(15-18)27-22(24)29-23-26-16(2)14-20(28-23)25-13-12-17-8-5-4-6-9-17/h4-11,14-15H,3,12-13H2,1-2H3,(H4,24,25,26,27,28,29) |
| InChIKey | AEYUBTWRDZOOIQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 114.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[[(E)-N'-[4-methyl-6-(2-phenylethylamino)pyrimidin-2-yl]carbamimidoyl]amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[[(E)-N'-[4-methyl-6-(2-phenylethylamino)pyrimidin-2-yl]carbamimidoyl]amino]benzoate?
The IUPAC name of ethyl 3-[[(E)-N'-[4-methyl-6-(2-phenylethylamino)pyrimidin-2-yl]carbamimidoyl]amino]benzoate (CID 44532427) is ethyl 3-[[(E)-N'-[4-methyl-6-(2-phenylethylamino)pyrimidin-2-yl]carbamimidoyl]amino]benzoate.
What is the SMILES notation for ethyl 3-[[(E)-N'-[4-methyl-6-(2-phenylethylamino)pyrimidin-2-yl]carbamimidoyl]amino]benzoate?
The canonical SMILES for ethyl 3-[[(E)-N'-[4-methyl-6-(2-phenylethylamino)pyrimidin-2-yl]carbamimidoyl]amino]benzoate is CCOC(=O)c1cccc(N/C(N)=N/c2nc(C)cc(NCCc3ccccc3)n2)c1.
What is the InChIKey of ethyl 3-[[(E)-N'-[4-methyl-6-(2-phenylethylamino)pyrimidin-2-yl]carbamimidoyl]amino]benzoate?
The InChIKey is AEYUBTWRDZOOIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N6O2/c1-3-31-21(30)18-10-7-11-19(15-18)27-22(24)29-23-26-16(2)14-20(28-23)25-13-12-17-8-5-4-6-9-17/h4-11,14-15H,3,12-13H2,1-2H3,(H4,24,25,26,27,28,29).
What are the key properties of ethyl 3-[[(E)-N'-[4-methyl-6-(2-phenylethylamino)pyrimidin-2-yl]carbamimidoyl]amino]benzoate?
ethyl 3-[[(E)-N'-[4-methyl-6-(2-phenylethylamino)pyrimidin-2-yl]carbamimidoyl]amino]benzoate has a molecular weight of 418.50 g/mol, XLogP of 3.67, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[[(E)-N'-[4-methyl-6-(2-phenylethylamino)pyrimidin-2-yl]carbamimidoyl]amino]benzoate is sourced from PubChem (CID 44532427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).