C29H29N5OS — CID 44532464
N',N'-dimethyl-N-[[4-[4-(4-phenoxyanilino)quinolin-7-yl]-1,3-thiazol-2-yl]methyl]ethane-1,2-diamine (PubChem CID 44532464) has the molecular formula C29H29N5OS and a molecular weight of 495.65 g/mol. Its IUPAC name is N',N'-dimethyl-N-[[4-[4-(4-phenoxyanilino)quinolin-7-yl]-1,3-thiazol-2-yl]methyl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-[[4-[4-(4-phenoxyanilino)quinolin-7-yl]-1,3-thiazol-2-yl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 44532464 |
| Molecular Formula | C29H29N5OS |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | N',N'-dimethyl-N-[[4-[4-(4-phenoxyanilino)quinolin-7-yl]-1,3-thiazol-2-yl]methyl]ethane-1,2-diamine |
| SMILES | CN(C)CCNCc1nc(-c2ccc3c(Nc4ccc(Oc5ccccc5)cc4)ccnc3c2)cs1 |
| InChI | InChI=1S/C29H29N5OS/c1-34(2)17-16-30-19-29-33-28(20-36-29)21-8-13-25-26(14-15-31-27(25)18-21)32-22-9-11-24(12-10-22)35-23-6-4-3-5-7-23/h3-15,18,20,30H,16-17,19H2,1-2H3,(H,31,32) |
| InChIKey | NTWRAXLZWRNEJP-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|