C30H35ClN4O3 — CID 44532487
4-[(4-chlorobenzoyl)amino]-N-[4-[4-(4-methoxy-2-methylphenyl)piperazin-1-yl]butyl]benzamide (PubChem CID 44532487) has the molecular formula C30H35ClN4O3 and a molecular weight of 535.09 g/mol. Its IUPAC name is 4-[(4-chlorobenzoyl)amino]-N-[4-[4-(4-methoxy-2-methylphenyl)piperazin-1-yl]butyl]benzamide.
| Compound Name | 4-[(4-chlorobenzoyl)amino]-N-[4-[4-(4-methoxy-2-methylphenyl)piperazin-1-yl]butyl]benzamide |
|---|---|
| PubChem CID | 44532487 |
| Molecular Formula | C30H35ClN4O3 |
| Molecular Weight | 535.09 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | 4-[(4-chlorobenzoyl)amino]-N-[4-[4-(4-methoxy-2-methylphenyl)piperazin-1-yl]butyl]benzamide |
| SMILES | COc1ccc(N2CCN(CCCCNC(=O)c3ccc(NC(=O)c4ccc(Cl)cc4)cc3)CC2)c(C)c1 |
| InChI | InChI=1S/C30H35ClN4O3/c1-22-21-27(38-2)13-14-28(22)35-19-17-34(18-20-35)16-4-3-15-32-29(36)23-7-11-26(12-8-23)33-30(37)24-5-9-25(31)10-6-24/h5-14,21H,3-4,15-20H2,1-2H3,(H,32,36)(H,33,37) |
| InChIKey | MKNMNOKYGSTFJI-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.09 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|