C23H23ClFN5S — CID 44532522
N-[[5-[4-(2-chloro-4-fluoroanilino)quinolin-7-yl]-1,3-thiazol-4-yl]methyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 44532522) has the molecular formula C23H23ClFN5S and a molecular weight of 455.99 g/mol. Its IUPAC name is N-[[5-[4-(2-chloro-4-fluoroanilino)quinolin-7-yl]-1,3-thiazol-4-yl]methyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[[5-[4-(2-chloro-4-fluoroanilino)quinolin-7-yl]-1,3-thiazol-4-yl]methyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 44532522 |
| Molecular Formula | C23H23ClFN5S |
| Molecular Weight | 455.99 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | N-[[5-[4-(2-chloro-4-fluoroanilino)quinolin-7-yl]-1,3-thiazol-4-yl]methyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNCc1ncsc1-c1ccc2c(Nc3ccc(F)cc3Cl)ccnc2c1 |
| InChI | InChI=1S/C23H23ClFN5S/c1-30(2)10-9-26-13-22-23(31-14-28-22)15-3-5-17-19(7-8-27-21(17)11-15)29-20-6-4-16(25)12-18(20)24/h3-8,11-12,14,26H,9-10,13H2,1-2H3,(H,27,29) |
| InChIKey | PIOIEYHZHOWJSG-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.99 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|