C31H31N5O — CID 44532548
N',N'-dimethyl-N-[[3-[4-(4-pyridin-2-yloxyanilino)quinolin-7-yl]phenyl]methyl]ethane-1,2-diamine (PubChem CID 44532548) has the molecular formula C31H31N5O and a molecular weight of 489.62 g/mol. Its IUPAC name is N',N'-dimethyl-N-[[3-[4-(4-pyridin-2-yloxyanilino)quinolin-7-yl]phenyl]methyl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-[[3-[4-(4-pyridin-2-yloxyanilino)quinolin-7-yl]phenyl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 44532548 |
| Molecular Formula | C31H31N5O |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | N',N'-dimethyl-N-[[3-[4-(4-pyridin-2-yloxyanilino)quinolin-7-yl]phenyl]methyl]ethane-1,2-diamine |
| SMILES | CN(C)CCNCc1cccc(-c2ccc3c(Nc4ccc(Oc5ccccn5)cc4)ccnc3c2)c1 |
| InChI | InChI=1S/C31H31N5O/c1-36(2)19-18-32-22-23-6-5-7-24(20-23)25-9-14-28-29(15-17-33-30(28)21-25)35-26-10-12-27(13-11-26)37-31-8-3-4-16-34-31/h3-17,20-21,32H,18-19,22H2,1-2H3,(H,33,35) |
| InChIKey | VDCKOJHSWSCVPD-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|