C20H18F3N3O5S2 — CID 44532584
N,5-bis(4-methylsulfonylphenyl)-4-(2,2,2-trifluoroethoxy)pyrimidin-2-amine (PubChem CID 44532584) has the molecular formula C20H18F3N3O5S2 and a molecular weight of 501.51 g/mol. Its IUPAC name is N,5-bis(4-methylsulfonylphenyl)-4-(2,2,2-trifluoroethoxy)pyrimidin-2-amine.
| Compound Name | N,5-bis(4-methylsulfonylphenyl)-4-(2,2,2-trifluoroethoxy)pyrimidin-2-amine |
|---|---|
| PubChem CID | 44532584 |
| Molecular Formula | C20H18F3N3O5S2 |
| Molecular Weight | 501.51 g/mol |
| Exact Mass | 501.06 |
| IUPAC Name | N,5-bis(4-methylsulfonylphenyl)-4-(2,2,2-trifluoroethoxy)pyrimidin-2-amine |
| SMILES | CS(=O)(=O)c1ccc(Nc2ncc(-c3ccc(S(C)(=O)=O)cc3)c(OCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C20H18F3N3O5S2/c1-32(27,28)15-7-3-13(4-8-15)17-11-24-19(26-18(17)31-12-20(21,22)23)25-14-5-9-16(10-6-14)33(2,29)30/h3-11H,12H2,1-2H3,(H,24,25,26) |
| InChIKey | JIAMRANUMNMXQV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |