C31H37ClF3N3O2 — CID 44532595
N-[4-[4-(2-ethoxy-4-methylphenyl)piperidin-1-yl]butyl]-4-[5-(trifluoromethyl)-2-pyridinyl]benzamide;hydrochloride (PubChem CID 44532595) has the molecular formula C31H37ClF3N3O2 and a molecular weight of 576.10 g/mol. Its IUPAC name is N-[4-[4-(2-ethoxy-4-methylphenyl)piperidin-1-yl]butyl]-4-[5-(trifluoromethyl)-2-pyridinyl]benzamide;hydrochloride.
| Compound Name | N-[4-[4-(2-ethoxy-4-methylphenyl)piperidin-1-yl]butyl]-4-[5-(trifluoromethyl)-2-pyridinyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 44532595 |
| Molecular Formula | C31H37ClF3N3O2 |
| Molecular Weight | 576.10 g/mol |
| Exact Mass | 575.25 |
| IUPAC Name | N-[4-[4-(2-ethoxy-4-methylphenyl)piperidin-1-yl]butyl]-4-[5-(trifluoromethyl)-2-pyridinyl]benzamide;hydrochloride |
| SMILES | CCOc1cc(C)ccc1C1CCN(CCCCNC(=O)c2ccc(-c3ccc(C(F)(F)F)cn3)cc2)CC1.Cl |
| InChI | InChI=1S/C31H36F3N3O2.ClH/c1-3-39-29-20-22(2)6-12-27(29)23-14-18-37(19-15-23)17-5-4-16-35-30(38)25-9-7-24(8-10-25)28-13-11-26(21-36-28)31(32,33)34;/h6-13,20-21,23H,3-5,14-19H2,1-2H3,(H,35,38);1H |
| InChIKey | NVQNAFQOTCAIIJ-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.10 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|