C30H37Cl2N3O2 — CID 44532629
4-(5-chloro-2-pyridinyl)-N-[4-[4-(2-ethoxy-4-methylphenyl)piperidin-1-yl]butyl]benzamide;hydrochloride (PubChem CID 44532629) has the molecular formula C30H37Cl2N3O2 and a molecular weight of 542.55 g/mol. Its IUPAC name is 4-(5-chloro-2-pyridinyl)-N-[4-[4-(2-ethoxy-4-methylphenyl)piperidin-1-yl]butyl]benzamide;hydrochloride.
| Compound Name | 4-(5-chloro-2-pyridinyl)-N-[4-[4-(2-ethoxy-4-methylphenyl)piperidin-1-yl]butyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 44532629 |
| Molecular Formula | C30H37Cl2N3O2 |
| Molecular Weight | 542.55 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | 4-(5-chloro-2-pyridinyl)-N-[4-[4-(2-ethoxy-4-methylphenyl)piperidin-1-yl]butyl]benzamide;hydrochloride |
| SMILES | CCOc1cc(C)ccc1C1CCN(CCCCNC(=O)c2ccc(-c3ccc(Cl)cn3)cc2)CC1.Cl |
| InChI | InChI=1S/C30H36ClN3O2.ClH/c1-3-36-29-20-22(2)6-12-27(29)23-14-18-34(19-15-23)17-5-4-16-32-30(35)25-9-7-24(8-10-25)28-13-11-26(31)21-33-28;/h6-13,20-21,23H,3-5,14-19H2,1-2H3,(H,32,35);1H |
| InChIKey | UESIEXPKQLWFCJ-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.55 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|