C32H38ClN3O2 — CID 44532648
4-(5-chloro-2-pyridinyl)-N-[4-[4-(2-methoxy-5,6,7,8-tetrahydronaphthalen-1-yl)piperidin-1-yl]butyl]benzamide (PubChem CID 44532648) has the molecular formula C32H38ClN3O2 and a molecular weight of 532.13 g/mol. Its IUPAC name is 4-(5-chloro-2-pyridinyl)-N-[4-[4-(2-methoxy-5,6,7,8-tetrahydronaphthalen-1-yl)piperidin-1-yl]butyl]benzamide.
| Compound Name | 4-(5-chloro-2-pyridinyl)-N-[4-[4-(2-methoxy-5,6,7,8-tetrahydronaphthalen-1-yl)piperidin-1-yl]butyl]benzamide |
|---|---|
| PubChem CID | 44532648 |
| Molecular Formula | C32H38ClN3O2 |
| Molecular Weight | 532.13 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | 4-(5-chloro-2-pyridinyl)-N-[4-[4-(2-methoxy-5,6,7,8-tetrahydronaphthalen-1-yl)piperidin-1-yl]butyl]benzamide |
| SMILES | COc1ccc2c(c1C1CCN(CCCCNC(=O)c3ccc(-c4ccc(Cl)cn4)cc3)CC1)CCCC2 |
| InChI | InChI=1S/C32H38ClN3O2/c1-38-30-15-12-23-6-2-3-7-28(23)31(30)25-16-20-36(21-17-25)19-5-4-18-34-32(37)26-10-8-24(9-11-26)29-14-13-27(33)22-35-29/h8-15,22,25H,2-7,16-21H2,1H3,(H,34,37) |
| InChIKey | CUBLLJHFBIQRIH-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.13 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|