About 2-N-(3-methylbutyl)-3-N-[3-(trifluoromethyl)phenyl]quinoxaline-2,3-diamine
2-N-(3-methylbutyl)-3-N-[3-(trifluoromethyl)phenyl]quinoxaline-2,3-diamine (PubChem CID 44532651) has the molecular formula C20H21F3N4
and a molecular weight of 374.41 g/mol. Its IUPAC name is 2-N-(3-methylbutyl)-3-N-[3-(trifluoromethyl)phenyl]quinoxaline-2,3-diamine.
Molecular Properties
| Compound Name | 2-N-(3-methylbutyl)-3-N-[3-(trifluoromethyl)phenyl]quinoxaline-2,3-diamine |
| PubChem CID | 44532651 |
| Molecular Formula | C20H21F3N4 |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 2-N-(3-methylbutyl)-3-N-[3-(trifluoromethyl)phenyl]quinoxaline-2,3-diamine |
| SMILES | CC(C)CCNc1nc2ccccc2nc1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H21F3N4/c1-13(2)10-11-24-18-19(27-17-9-4-3-8-16(17)26-18)25-15-7-5-6-14(12-15)20(21,22)23/h3-9,12-13H,10-11H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | MFBFYWQWLXEPJV-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-N-(3-methylbutyl)-3-N-[3-(trifluoromethyl)phenyl]quinoxaline-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(3-methylbutyl)-3-N-[3-(trifluoromethyl)phenyl]quinoxaline-2,3-diamine?
The IUPAC name of 2-N-(3-methylbutyl)-3-N-[3-(trifluoromethyl)phenyl]quinoxaline-2,3-diamine (CID 44532651) is 2-N-(3-methylbutyl)-3-N-[3-(trifluoromethyl)phenyl]quinoxaline-2,3-diamine.
What is the SMILES notation for 2-N-(3-methylbutyl)-3-N-[3-(trifluoromethyl)phenyl]quinoxaline-2,3-diamine?
The canonical SMILES for 2-N-(3-methylbutyl)-3-N-[3-(trifluoromethyl)phenyl]quinoxaline-2,3-diamine is CC(C)CCNc1nc2ccccc2nc1Nc1cccc(C(F)(F)F)c1.
What is the InChIKey of 2-N-(3-methylbutyl)-3-N-[3-(trifluoromethyl)phenyl]quinoxaline-2,3-diamine?
The InChIKey is MFBFYWQWLXEPJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21F3N4/c1-13(2)10-11-24-18-19(27-17-9-4-3-8-16(17)26-18)25-15-7-5-6-14(12-15)20(21,22)23/h3-9,12-13H,10-11H2,1-2H3,(H,24,26)(H,25,27).
What are the key properties of 2-N-(3-methylbutyl)-3-N-[3-(trifluoromethyl)phenyl]quinoxaline-2,3-diamine?
2-N-(3-methylbutyl)-3-N-[3-(trifluoromethyl)phenyl]quinoxaline-2,3-diamine has a molecular weight of 374.41 g/mol, XLogP of 5.85, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(3-methylbutyl)-3-N-[3-(trifluoromethyl)phenyl]quinoxaline-2,3-diamine is sourced from PubChem (CID 44532651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).