C31H37N7O — CID 44532695
2-N-[3-[[3-(4-methylpiperazin-1-yl)propylamino]methyl]phenyl]-4-N-(4-phenoxyphenyl)pyrimidine-2,4-diamine (PubChem CID 44532695) has the molecular formula C31H37N7O and a molecular weight of 523.69 g/mol. Its IUPAC name is 2-N-[3-[[3-(4-methylpiperazin-1-yl)propylamino]methyl]phenyl]-4-N-(4-phenoxyphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[3-[[3-(4-methylpiperazin-1-yl)propylamino]methyl]phenyl]-4-N-(4-phenoxyphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 44532695 |
| Molecular Formula | C31H37N7O |
| Molecular Weight | 523.69 g/mol |
| Exact Mass | 523.31 |
| IUPAC Name | 2-N-[3-[[3-(4-methylpiperazin-1-yl)propylamino]methyl]phenyl]-4-N-(4-phenoxyphenyl)pyrimidine-2,4-diamine |
| SMILES | CN1CCN(CCCNCc2cccc(Nc3nccc(Nc4ccc(Oc5ccccc5)cc4)n3)c2)CC1 |
| InChI | InChI=1S/C31H37N7O/c1-37-19-21-38(22-20-37)18-6-16-32-24-25-7-5-8-27(23-25)35-31-33-17-15-30(36-31)34-26-11-13-29(14-12-26)39-28-9-3-2-4-10-28/h2-5,7-15,17,23,32H,6,16,18-22,24H2,1H3,(H2,33,34,35,36) |
| InChIKey | MVXFDLSQEPNUTP-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.69 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|