C32H37ClN2O2 — CID 44532738
4-(4-chlorophenyl)-N-[4-[4-(1-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)piperidin-1-yl]butyl]benzamide (PubChem CID 44532738) has the molecular formula C32H37ClN2O2 and a molecular weight of 517.11 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[4-[4-(1-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)piperidin-1-yl]butyl]benzamide.
| Compound Name | 4-(4-chlorophenyl)-N-[4-[4-(1-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)piperidin-1-yl]butyl]benzamide |
|---|---|
| PubChem CID | 44532738 |
| Molecular Formula | C32H37ClN2O2 |
| Molecular Weight | 517.11 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[4-[4-(1-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)piperidin-1-yl]butyl]benzamide |
| SMILES | O=C(NCCCCN1CCC(c2ccc3c(c2O)CCCC3)CC1)c1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C32H37ClN2O2/c33-28-14-11-24(12-15-28)23-7-9-27(10-8-23)32(37)34-19-3-4-20-35-21-17-26(18-22-35)30-16-13-25-5-1-2-6-29(25)31(30)36/h7-16,26,36H,1-6,17-22H2,(H,34,37) |
| InChIKey | QMTHJWZCYYBKPO-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.11 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|