C29H32ClN3O3 — CID 44532766
4-[(4-chlorobenzoyl)amino]-N-[4-[(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)amino]butyl]benzamide (PubChem CID 44532766) has the molecular formula C29H32ClN3O3 and a molecular weight of 506.05 g/mol. Its IUPAC name is 4-[(4-chlorobenzoyl)amino]-N-[4-[(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)amino]butyl]benzamide.
| Compound Name | 4-[(4-chlorobenzoyl)amino]-N-[4-[(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)amino]butyl]benzamide |
|---|---|
| PubChem CID | 44532766 |
| Molecular Formula | C29H32ClN3O3 |
| Molecular Weight | 506.05 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | 4-[(4-chlorobenzoyl)amino]-N-[4-[(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)amino]butyl]benzamide |
| SMILES | COc1ccc2c(c1)CCCC2NCCCCNC(=O)c1ccc(NC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C29H32ClN3O3/c1-36-25-15-16-26-22(19-25)5-4-6-27(26)31-17-2-3-18-32-28(34)20-9-13-24(14-10-20)33-29(35)21-7-11-23(30)12-8-21/h7-16,19,27,31H,2-6,17-18H2,1H3,(H,32,34)(H,33,35) |
| InChIKey | NVTTWQSTOCPNHX-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.05 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|