About (4-phenylmethoxyphenyl)methyl 2-(2-imino-3-methylbenzimidazol-1-yl)acetate;hydrobromide
(4-phenylmethoxyphenyl)methyl 2-(2-imino-3-methylbenzimidazol-1-yl)acetate;hydrobromide (PubChem CID 44532777) has the molecular formula C24H24BrN3O3
and a molecular weight of 482.38 g/mol. Its IUPAC name is (4-phenylmethoxyphenyl)methyl 2-(2-imino-3-methylbenzimidazol-1-yl)acetate;hydrobromide.
Molecular Properties
| Compound Name | (4-phenylmethoxyphenyl)methyl 2-(2-imino-3-methylbenzimidazol-1-yl)acetate;hydrobromide |
| PubChem CID | 44532777 |
| Molecular Formula | C24H24BrN3O3 |
| Molecular Weight | 482.38 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | (4-phenylmethoxyphenyl)methyl 2-(2-imino-3-methylbenzimidazol-1-yl)acetate;hydrobromide |
| SMILES | Br.[H]/N=c1\n(C)c2ccccc2n1CC(=O)OCc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H23N3O3.BrH/c1-26-21-9-5-6-10-22(21)27(24(26)25)15-23(28)30-17-19-11-13-20(14-12-19)29-16-18-7-3-2-4-8-18;/h2-14,25H,15-17H2,1H3;1H/b25-24+; |
| InChIKey | QBXHRBVTPNIKSI-QREUMGABSA-N |
| XLogP | 4.36 |
| TPSA | 69.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 482.38 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (4-phenylmethoxyphenyl)methyl 2-(2-imino-3-methylbenzimidazol-1-yl)acetate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-phenylmethoxyphenyl)methyl 2-(2-imino-3-methylbenzimidazol-1-yl)acetate;hydrobromide?
The IUPAC name of (4-phenylmethoxyphenyl)methyl 2-(2-imino-3-methylbenzimidazol-1-yl)acetate;hydrobromide (CID 44532777) is (4-phenylmethoxyphenyl)methyl 2-(2-imino-3-methylbenzimidazol-1-yl)acetate;hydrobromide.
What is the SMILES notation for (4-phenylmethoxyphenyl)methyl 2-(2-imino-3-methylbenzimidazol-1-yl)acetate;hydrobromide?
The canonical SMILES for (4-phenylmethoxyphenyl)methyl 2-(2-imino-3-methylbenzimidazol-1-yl)acetate;hydrobromide is Br.[H]/N=c1\n(C)c2ccccc2n1CC(=O)OCc1ccc(OCc2ccccc2)cc1.
What is the InChIKey of (4-phenylmethoxyphenyl)methyl 2-(2-imino-3-methylbenzimidazol-1-yl)acetate;hydrobromide?
The InChIKey is QBXHRBVTPNIKSI-QREUMGABSA-N. The full InChI is InChI=1S/C24H23N3O3.BrH/c1-26-21-9-5-6-10-22(21)27(24(26)25)15-23(28)30-17-19-11-13-20(14-12-19)29-16-18-7-3-2-4-8-18;/h2-14,25H,15-17H2,1H3;1H/b25-24+;.
What are the key properties of (4-phenylmethoxyphenyl)methyl 2-(2-imino-3-methylbenzimidazol-1-yl)acetate;hydrobromide?
(4-phenylmethoxyphenyl)methyl 2-(2-imino-3-methylbenzimidazol-1-yl)acetate;hydrobromide has a molecular weight of 482.38 g/mol, XLogP of 4.36, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-phenylmethoxyphenyl)methyl 2-(2-imino-3-methylbenzimidazol-1-yl)acetate;hydrobromide is sourced from PubChem (CID 44532777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).