C25H30N8O — CID 44532814
N'-[[4-[(E)-[[1-(3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]hydrazinylidene]methyl]phenyl]methyl]-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 44532814) has the molecular formula C25H30N8O and a molecular weight of 458.57 g/mol. Its IUPAC name is N'-[[4-[(E)-[[1-(3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]hydrazinylidene]methyl]phenyl]methyl]-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | N'-[[4-[(E)-[[1-(3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]hydrazinylidene]methyl]phenyl]methyl]-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 44532814 |
| Molecular Formula | C25H30N8O |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | N'-[[4-[(E)-[[1-(3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]hydrazinylidene]methyl]phenyl]methyl]-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | COc1cccc(-n2ncc3c(N/N=C/c4ccc(CN(C)CCN(C)C)cc4)ncnc32)c1 |
| InChI | InChI=1S/C25H30N8O/c1-31(2)12-13-32(3)17-20-10-8-19(9-11-20)15-28-30-24-23-16-29-33(25(23)27-18-26-24)21-6-5-7-22(14-21)34-4/h5-11,14-16,18H,12-13,17H2,1-4H3,(H,26,27,30)/b28-15+ |
| InChIKey | KKMISKJNIGRBBR-RWPZCVJISA-N |
| XLogP | 3.26 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|