C36H41F3N2O3 — CID 44532825
N-[4-[4-[1-(2-oxopropoxy)-5,6,7,8-tetrahydronaphthalen-2-yl]piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 44532825) has the molecular formula C36H41F3N2O3 and a molecular weight of 606.73 g/mol. Its IUPAC name is N-[4-[4-[1-(2-oxopropoxy)-5,6,7,8-tetrahydronaphthalen-2-yl]piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[4-[4-[1-(2-oxopropoxy)-5,6,7,8-tetrahydronaphthalen-2-yl]piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 44532825 |
| Molecular Formula | C36H41F3N2O3 |
| Molecular Weight | 606.73 g/mol |
| Exact Mass | 606.31 |
| IUPAC Name | N-[4-[4-[1-(2-oxopropoxy)-5,6,7,8-tetrahydronaphthalen-2-yl]piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | CC(=O)COc1c(C2CCN(CCCCNC(=O)c3ccc(-c4ccc(C(F)(F)F)cc4)cc3)CC2)ccc2c1CCCC2 |
| InChI | InChI=1S/C36H41F3N2O3/c1-25(42)24-44-34-32-7-3-2-6-28(32)14-17-33(34)29-18-22-41(23-19-29)21-5-4-20-40-35(43)30-10-8-26(9-11-30)27-12-15-31(16-13-27)36(37,38)39/h8-17,29H,2-7,18-24H2,1H3,(H,40,43) |
| InChIKey | FYVCXARDFGTCOB-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.73 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|