C33H39F3N2O3 — CID 44532890
N-[4-[4-[4-(2-hydroxyethoxy)-2,5-dimethylphenyl]piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 44532890) has the molecular formula C33H39F3N2O3 and a molecular weight of 568.68 g/mol. Its IUPAC name is N-[4-[4-[4-(2-hydroxyethoxy)-2,5-dimethylphenyl]piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[4-[4-[4-(2-hydroxyethoxy)-2,5-dimethylphenyl]piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 44532890 |
| Molecular Formula | C33H39F3N2O3 |
| Molecular Weight | 568.68 g/mol |
| Exact Mass | 568.29 |
| IUPAC Name | N-[4-[4-[4-(2-hydroxyethoxy)-2,5-dimethylphenyl]piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1cc(C2CCN(CCCCNC(=O)c3ccc(-c4ccc(C(F)(F)F)cc4)cc3)CC2)c(C)cc1OCCO |
| InChI | InChI=1S/C33H39F3N2O3/c1-23-22-31(41-20-19-39)24(2)21-30(23)27-13-17-38(18-14-27)16-4-3-15-37-32(40)28-7-5-25(6-8-28)26-9-11-29(12-10-26)33(34,35)36/h5-12,21-22,27,39H,3-4,13-20H2,1-2H3,(H,37,40) |
| InChIKey | OHUAUAWWGRRVLG-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.68 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|