C33H38F3N3O3 — CID 44532892
N-[4-[4-[4-(2-amino-2-oxoethoxy)-2,5-dimethylphenyl]piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 44532892) has the molecular formula C33H38F3N3O3 and a molecular weight of 581.68 g/mol. Its IUPAC name is N-[4-[4-[4-(2-amino-2-oxoethoxy)-2,5-dimethylphenyl]piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[4-[4-[4-(2-amino-2-oxoethoxy)-2,5-dimethylphenyl]piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 44532892 |
| Molecular Formula | C33H38F3N3O3 |
| Molecular Weight | 581.68 g/mol |
| Exact Mass | 581.29 |
| IUPAC Name | N-[4-[4-[4-(2-amino-2-oxoethoxy)-2,5-dimethylphenyl]piperidin-1-yl]butyl]-4-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1cc(C2CCN(CCCCNC(=O)c3ccc(-c4ccc(C(F)(F)F)cc4)cc3)CC2)c(C)cc1OCC(N)=O |
| InChI | InChI=1S/C33H38F3N3O3/c1-22-20-30(42-21-31(37)40)23(2)19-29(22)26-13-17-39(18-14-26)16-4-3-15-38-32(41)27-7-5-24(6-8-27)25-9-11-28(12-10-25)33(34,35)36/h5-12,19-20,26H,3-4,13-18,21H2,1-2H3,(H2,37,40)(H,38,41) |
| InChIKey | NRRABKYYQJOUFO-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.68 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|