About 4-(2,4-dichlorophenyl)-N-[3-[2-(dimethylamino)ethoxy]-4-phenylphenyl]benzamide
4-(2,4-dichlorophenyl)-N-[3-[2-(dimethylamino)ethoxy]-4-phenylphenyl]benzamide (PubChem CID 44532927) has the molecular formula C29H26Cl2N2O2
and a molecular weight of 505.45 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-N-[3-[2-(dimethylamino)ethoxy]-4-phenylphenyl]benzamide.
Molecular Properties
| Compound Name | 4-(2,4-dichlorophenyl)-N-[3-[2-(dimethylamino)ethoxy]-4-phenylphenyl]benzamide |
| PubChem CID | 44532927 |
| Molecular Formula | C29H26Cl2N2O2 |
| Molecular Weight | 505.45 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-N-[3-[2-(dimethylamino)ethoxy]-4-phenylphenyl]benzamide |
| SMILES | CN(C)CCOc1cc(NC(=O)c2ccc(-c3ccc(Cl)cc3Cl)cc2)ccc1-c1ccccc1 |
| InChI | InChI=1S/C29H26Cl2N2O2/c1-33(2)16-17-35-28-19-24(13-15-26(28)20-6-4-3-5-7-20)32-29(34)22-10-8-21(9-11-22)25-14-12-23(30)18-27(25)31/h3-15,18-19H,16-17H2,1-2H3,(H,32,34) |
| InChIKey | KLUQCKXQCZDUAJ-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 505.45 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2,4-dichlorophenyl)-N-[3-[2-(dimethylamino)ethoxy]-4-phenylphenyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-dichlorophenyl)-N-[3-[2-(dimethylamino)ethoxy]-4-phenylphenyl]benzamide?
The IUPAC name of 4-(2,4-dichlorophenyl)-N-[3-[2-(dimethylamino)ethoxy]-4-phenylphenyl]benzamide (CID 44532927) is 4-(2,4-dichlorophenyl)-N-[3-[2-(dimethylamino)ethoxy]-4-phenylphenyl]benzamide.
What is the SMILES notation for 4-(2,4-dichlorophenyl)-N-[3-[2-(dimethylamino)ethoxy]-4-phenylphenyl]benzamide?
The canonical SMILES for 4-(2,4-dichlorophenyl)-N-[3-[2-(dimethylamino)ethoxy]-4-phenylphenyl]benzamide is CN(C)CCOc1cc(NC(=O)c2ccc(-c3ccc(Cl)cc3Cl)cc2)ccc1-c1ccccc1.
What is the InChIKey of 4-(2,4-dichlorophenyl)-N-[3-[2-(dimethylamino)ethoxy]-4-phenylphenyl]benzamide?
The InChIKey is KLUQCKXQCZDUAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H26Cl2N2O2/c1-33(2)16-17-35-28-19-24(13-15-26(28)20-6-4-3-5-7-20)32-29(34)22-10-8-21(9-11-22)25-14-12-23(30)18-27(25)31/h3-15,18-19H,16-17H2,1-2H3,(H,32,34).
What are the key properties of 4-(2,4-dichlorophenyl)-N-[3-[2-(dimethylamino)ethoxy]-4-phenylphenyl]benzamide?
4-(2,4-dichlorophenyl)-N-[3-[2-(dimethylamino)ethoxy]-4-phenylphenyl]benzamide has a molecular weight of 505.45 g/mol, XLogP of 7.52, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dichlorophenyl)-N-[3-[2-(dimethylamino)ethoxy]-4-phenylphenyl]benzamide is sourced from PubChem (CID 44532927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).