C36H48N4O6S — CID 44532986
5-(1,1-dioxothiazinan-2-yl)-1-N-[(2S,3R)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-phenylbutan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 44532986) has the molecular formula C36H48N4O6S and a molecular weight of 664.87 g/mol. Its IUPAC name is 5-(1,1-dioxothiazinan-2-yl)-1-N-[(2S,3R)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-phenylbutan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 5-(1,1-dioxothiazinan-2-yl)-1-N-[(2S,3R)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-phenylbutan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 44532986 |
| Molecular Formula | C36H48N4O6S |
| Molecular Weight | 664.87 g/mol |
| Exact Mass | 664.33 |
| IUPAC Name | 5-(1,1-dioxothiazinan-2-yl)-1-N-[(2S,3R)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-phenylbutan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C(=O)N[C@@H](Cc2ccccc2)[C@H](O)CNCc2cccc(OC)c2)cc(N2CCCCS2(=O)=O)c1 |
| InChI | InChI=1S/C36H48N4O6S/c1-4-16-39(17-5-2)36(43)30-22-29(23-31(24-30)40-18-9-10-19-47(40,44)45)35(42)38-33(21-27-12-7-6-8-13-27)34(41)26-37-25-28-14-11-15-32(20-28)46-3/h6-8,11-15,20,22-24,33-34,37,41H,4-5,9-10,16-19,21,25-26H2,1-3H3,(H,38,42)/t33-,34+/m0/s1 |
| InChIKey | OJKFYYWZUWDHRB-SZAHLOSFSA-N |
| XLogP | 4.38 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.87 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |