C31H32N2O — CID 44533062
(4aS,12aR)-2-ethyl-4a-(3-methoxyphenyl)-11-phenyl-1,3,4,5,12,12a-hexahydropyrido[3,4-b]acridine (PubChem CID 44533062) has the molecular formula C31H32N2O and a molecular weight of 448.61 g/mol. Its IUPAC name is (4aS,12aR)-2-ethyl-4a-(3-methoxyphenyl)-11-phenyl-1,3,4,5,12,12a-hexahydropyrido[3,4-b]acridine.
| Compound Name | (4aS,12aR)-2-ethyl-4a-(3-methoxyphenyl)-11-phenyl-1,3,4,5,12,12a-hexahydropyrido[3,4-b]acridine |
|---|---|
| PubChem CID | 44533062 |
| Molecular Formula | C31H32N2O |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | (4aS,12aR)-2-ethyl-4a-(3-methoxyphenyl)-11-phenyl-1,3,4,5,12,12a-hexahydropyrido[3,4-b]acridine |
| SMILES | CCN1CC[C@]2(c3cccc(OC)c3)Cc3nc4ccccc4c(-c4ccccc4)c3C[C@H]2C1 |
| InChI | InChI=1S/C31H32N2O/c1-3-33-17-16-31(23-12-9-13-25(18-23)34-2)20-29-27(19-24(31)21-33)30(22-10-5-4-6-11-22)26-14-7-8-15-28(26)32-29/h4-15,18,24H,3,16-17,19-21H2,1-2H3/t24-,31+/m0/s1 |
| InChIKey | UEGULVGUPOVLGQ-QXNWPYRLSA-N |
| XLogP | 6.29 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |