C20H25Cl2N3O2 — CID 44533114
(2Z,4E)-5-(5,6-dichloro-1H-indol-2-yl)-N-[2-(diethylamino)ethyl]-2-methoxypenta-2,4-dienamide (PubChem CID 44533114) has the molecular formula C20H25Cl2N3O2 and a molecular weight of 410.35 g/mol. Its IUPAC name is (2Z,4E)-5-(5,6-dichloro-1H-indol-2-yl)-N-[2-(diethylamino)ethyl]-2-methoxypenta-2,4-dienamide.
| Compound Name | (2Z,4E)-5-(5,6-dichloro-1H-indol-2-yl)-N-[2-(diethylamino)ethyl]-2-methoxypenta-2,4-dienamide |
|---|---|
| PubChem CID | 44533114 |
| Molecular Formula | C20H25Cl2N3O2 |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | (2Z,4E)-5-(5,6-dichloro-1H-indol-2-yl)-N-[2-(diethylamino)ethyl]-2-methoxypenta-2,4-dienamide |
| SMILES | CCN(CC)CCNC(=O)/C(=C/C=C/c1cc2cc(Cl)c(Cl)cc2[nH]1)OC |
| InChI | InChI=1S/C20H25Cl2N3O2/c1-4-25(5-2)10-9-23-20(26)19(27-3)8-6-7-15-11-14-12-16(21)17(22)13-18(14)24-15/h6-8,11-13,24H,4-5,9-10H2,1-3H3,(H,23,26)/b7-6+,19-8- |
| InChIKey | ZNWYLLXKMFSNME-XWTWHVSOSA-N |
| XLogP | 4.48 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|