About 4,5-diphenyl-N-pyridin-4-yl-1,3-thiazol-2-amine;hydrobromide
4,5-diphenyl-N-pyridin-4-yl-1,3-thiazol-2-amine;hydrobromide (PubChem CID 44533128) has the molecular formula C20H16BrN3S
and a molecular weight of 410.34 g/mol. Its IUPAC name is 4,5-diphenyl-N-pyridin-4-yl-1,3-thiazol-2-amine;hydrobromide.
Molecular Properties
| Compound Name | 4,5-diphenyl-N-pyridin-4-yl-1,3-thiazol-2-amine;hydrobromide |
| PubChem CID | 44533128 |
| Molecular Formula | C20H16BrN3S |
| Molecular Weight | 410.34 g/mol |
| Exact Mass | 409.02 |
| IUPAC Name | 4,5-diphenyl-N-pyridin-4-yl-1,3-thiazol-2-amine;hydrobromide |
| SMILES | Br.c1ccc(-c2nc(Nc3ccncc3)sc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H15N3S.BrH/c1-3-7-15(8-4-1)18-19(16-9-5-2-6-10-16)24-20(23-18)22-17-11-13-21-14-12-17;/h1-14H,(H,21,22,23);1H |
| InChIKey | AQVZREONBPMAFE-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.34 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,5-diphenyl-N-pyridin-4-yl-1,3-thiazol-2-amine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-diphenyl-N-pyridin-4-yl-1,3-thiazol-2-amine;hydrobromide?
The IUPAC name of 4,5-diphenyl-N-pyridin-4-yl-1,3-thiazol-2-amine;hydrobromide (CID 44533128) is 4,5-diphenyl-N-pyridin-4-yl-1,3-thiazol-2-amine;hydrobromide.
What is the SMILES notation for 4,5-diphenyl-N-pyridin-4-yl-1,3-thiazol-2-amine;hydrobromide?
The canonical SMILES for 4,5-diphenyl-N-pyridin-4-yl-1,3-thiazol-2-amine;hydrobromide is Br.c1ccc(-c2nc(Nc3ccncc3)sc2-c2ccccc2)cc1.
What is the InChIKey of 4,5-diphenyl-N-pyridin-4-yl-1,3-thiazol-2-amine;hydrobromide?
The InChIKey is AQVZREONBPMAFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N3S.BrH/c1-3-7-15(8-4-1)18-19(16-9-5-2-6-10-16)24-20(23-18)22-17-11-13-21-14-12-17;/h1-14H,(H,21,22,23);1H.
What are the key properties of 4,5-diphenyl-N-pyridin-4-yl-1,3-thiazol-2-amine;hydrobromide?
4,5-diphenyl-N-pyridin-4-yl-1,3-thiazol-2-amine;hydrobromide has a molecular weight of 410.34 g/mol, XLogP of 6.19, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-diphenyl-N-pyridin-4-yl-1,3-thiazol-2-amine;hydrobromide is sourced from PubChem (CID 44533128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).