About 4-(3,5-dichlorophenyl)-2-(1H-indol-2-yl)aniline;hydrochloride
4-(3,5-dichlorophenyl)-2-(1H-indol-2-yl)aniline;hydrochloride (PubChem CID 44533154) has the molecular formula C20H15Cl3N2
and a molecular weight of 389.71 g/mol. Its IUPAC name is 4-(3,5-dichlorophenyl)-2-(1H-indol-2-yl)aniline;hydrochloride.
Molecular Properties
| Compound Name | 4-(3,5-dichlorophenyl)-2-(1H-indol-2-yl)aniline;hydrochloride |
| PubChem CID | 44533154 |
| Molecular Formula | C20H15Cl3N2 |
| Molecular Weight | 389.71 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | 4-(3,5-dichlorophenyl)-2-(1H-indol-2-yl)aniline;hydrochloride |
| SMILES | Cl.Nc1ccc(-c2cc(Cl)cc(Cl)c2)cc1-c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H14Cl2N2.ClH/c21-15-7-14(8-16(22)11-15)12-5-6-18(23)17(9-12)20-10-13-3-1-2-4-19(13)24-20;/h1-11,24H,23H2;1H |
| InChIKey | YHMJXRAGJXQQGT-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.71 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,5-dichlorophenyl)-2-(1H-indol-2-yl)aniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-dichlorophenyl)-2-(1H-indol-2-yl)aniline;hydrochloride?
The IUPAC name of 4-(3,5-dichlorophenyl)-2-(1H-indol-2-yl)aniline;hydrochloride (CID 44533154) is 4-(3,5-dichlorophenyl)-2-(1H-indol-2-yl)aniline;hydrochloride.
What is the SMILES notation for 4-(3,5-dichlorophenyl)-2-(1H-indol-2-yl)aniline;hydrochloride?
The canonical SMILES for 4-(3,5-dichlorophenyl)-2-(1H-indol-2-yl)aniline;hydrochloride is Cl.Nc1ccc(-c2cc(Cl)cc(Cl)c2)cc1-c1cc2ccccc2[nH]1.
What is the InChIKey of 4-(3,5-dichlorophenyl)-2-(1H-indol-2-yl)aniline;hydrochloride?
The InChIKey is YHMJXRAGJXQQGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14Cl2N2.ClH/c21-15-7-14(8-16(22)11-15)12-5-6-18(23)17(9-12)20-10-13-3-1-2-4-19(13)24-20;/h1-11,24H,23H2;1H.
What are the key properties of 4-(3,5-dichlorophenyl)-2-(1H-indol-2-yl)aniline;hydrochloride?
4-(3,5-dichlorophenyl)-2-(1H-indol-2-yl)aniline;hydrochloride has a molecular weight of 389.71 g/mol, XLogP of 6.81, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dichlorophenyl)-2-(1H-indol-2-yl)aniline;hydrochloride is sourced from PubChem (CID 44533154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).