C23H29Cl2N3O2 — CID 44533166
(2Z,4E)-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxy-N-[3-[(2R)-2-methylpiperidin-1-yl]propyl]penta-2,4-dienamide (PubChem CID 44533166) has the molecular formula C23H29Cl2N3O2 and a molecular weight of 450.41 g/mol. Its IUPAC name is (2Z,4E)-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxy-N-[3-[(2R)-2-methylpiperidin-1-yl]propyl]penta-2,4-dienamide.
| Compound Name | (2Z,4E)-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxy-N-[3-[(2R)-2-methylpiperidin-1-yl]propyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 44533166 |
| Molecular Formula | C23H29Cl2N3O2 |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | (2Z,4E)-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxy-N-[3-[(2R)-2-methylpiperidin-1-yl]propyl]penta-2,4-dienamide |
| SMILES | CO/C(=C\C=C\c1cc2cc(Cl)c(Cl)cc2[nH]1)C(=O)NCCCN1CCCC[C@H]1C |
| InChI | InChI=1S/C23H29Cl2N3O2/c1-16-7-3-4-11-28(16)12-6-10-26-23(29)22(30-2)9-5-8-18-13-17-14-19(24)20(25)15-21(17)27-18/h5,8-9,13-16,27H,3-4,6-7,10-12H2,1-2H3,(H,26,29)/b8-5+,22-9-/t16-/m1/s1 |
| InChIKey | WJVNIRVCFWWYIQ-OACKQWDFSA-N |
| XLogP | 5.40 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|