C29H35N3O2 — CID 44533183
N-[4-[(5-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]butyl]-4-pyridin-3-ylbenzamide (PubChem CID 44533183) has the molecular formula C29H35N3O2 and a molecular weight of 457.62 g/mol. Its IUPAC name is N-[4-[(5-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]butyl]-4-pyridin-3-ylbenzamide.
| Compound Name | N-[4-[(5-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]butyl]-4-pyridin-3-ylbenzamide |
|---|---|
| PubChem CID | 44533183 |
| Molecular Formula | C29H35N3O2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | N-[4-[(5-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]butyl]-4-pyridin-3-ylbenzamide |
| SMILES | CCCN(CCCCNC(=O)c1ccc(-c2cccnc2)cc1)C1CCc2c(O)cccc2C1 |
| InChI | InChI=1S/C29H35N3O2/c1-2-18-32(26-14-15-27-24(20-26)7-5-9-28(27)33)19-4-3-17-31-29(34)23-12-10-22(11-13-23)25-8-6-16-30-21-25/h5-13,16,21,26,33H,2-4,14-15,17-20H2,1H3,(H,31,34) |
| InChIKey | CHTBFOOGLPVTCI-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|