C27H33Cl2N3O2 — CID 44533188
(2Z,4E)-N-[3-(1-adamantylamino)propyl]-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxypenta-2,4-dienamide (PubChem CID 44533188) has the molecular formula C27H33Cl2N3O2 and a molecular weight of 502.49 g/mol. Its IUPAC name is (2Z,4E)-N-[3-(1-adamantylamino)propyl]-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxypenta-2,4-dienamide.
| Compound Name | (2Z,4E)-N-[3-(1-adamantylamino)propyl]-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxypenta-2,4-dienamide |
|---|---|
| PubChem CID | 44533188 |
| Molecular Formula | C27H33Cl2N3O2 |
| Molecular Weight | 502.49 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | (2Z,4E)-N-[3-(1-adamantylamino)propyl]-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxypenta-2,4-dienamide |
| SMILES | CO/C(=C\C=C\c1cc2cc(Cl)c(Cl)cc2[nH]1)C(=O)NCCCNC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C27H33Cl2N3O2/c1-34-25(5-2-4-21-11-20-12-22(28)23(29)13-24(20)32-21)26(33)30-6-3-7-31-27-14-17-8-18(15-27)10-19(9-17)16-27/h2,4-5,11-13,17-19,31-32H,3,6-10,14-16H2,1H3,(H,30,33)/b4-2+,25-5- |
| InChIKey | YUBQFPLKPBQTRE-FWPKSBLBSA-N |
| XLogP | 6.08 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.49 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|