C21H23Cl2N3O2 — CID 44533205
(2Z,4E)-N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxypenta-2,4-dienamide (PubChem CID 44533205) has the molecular formula C21H23Cl2N3O2 and a molecular weight of 420.34 g/mol. Its IUPAC name is (2Z,4E)-N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxypenta-2,4-dienamide.
| Compound Name | (2Z,4E)-N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxypenta-2,4-dienamide |
|---|---|
| PubChem CID | 44533205 |
| Molecular Formula | C21H23Cl2N3O2 |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | (2Z,4E)-N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxypenta-2,4-dienamide |
| SMILES | CO/C(=C\C=C\c1cc2cc(Cl)c(Cl)cc2[nH]1)C(=O)N[C@H]1CN2CCC1CC2 |
| InChI | InChI=1S/C21H23Cl2N3O2/c1-28-20(21(27)25-19-12-26-7-5-13(19)6-8-26)4-2-3-15-9-14-10-16(22)17(23)11-18(14)24-15/h2-4,9-11,13,19,24H,5-8,12H2,1H3,(H,25,27)/b3-2+,20-4-/t19-/m0/s1 |
| InChIKey | DMTRKCFYVGKARW-GSXPTJSQSA-N |
| XLogP | 4.23 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|