About (1-methylpiperidin-4-yl) 1-(benzenesulfonyl)-5-phenylindole-2-carboxylate;hydrochloride
(1-methylpiperidin-4-yl) 1-(benzenesulfonyl)-5-phenylindole-2-carboxylate;hydrochloride (PubChem CID 44533213) has the molecular formula C27H27ClN2O4S
and a molecular weight of 511.04 g/mol. Its IUPAC name is (1-methylpiperidin-4-yl) 1-(benzenesulfonyl)-5-phenylindole-2-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | (1-methylpiperidin-4-yl) 1-(benzenesulfonyl)-5-phenylindole-2-carboxylate;hydrochloride |
| PubChem CID | 44533213 |
| Molecular Formula | C27H27ClN2O4S |
| Molecular Weight | 511.04 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | (1-methylpiperidin-4-yl) 1-(benzenesulfonyl)-5-phenylindole-2-carboxylate;hydrochloride |
| SMILES | CN1CCC(OC(=O)c2cc3cc(-c4ccccc4)ccc3n2S(=O)(=O)c2ccccc2)CC1.Cl |
| InChI | InChI=1S/C27H26N2O4S.ClH/c1-28-16-14-23(15-17-28)33-27(30)26-19-22-18-21(20-8-4-2-5-9-20)12-13-25(22)29(26)34(31,32)24-10-6-3-7-11-24;/h2-13,18-19,23H,14-17H2,1H3;1H |
| InChIKey | RFNZERNDMRRUPM-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 511.04 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (1-methylpiperidin-4-yl) 1-(benzenesulfonyl)-5-phenylindole-2-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpiperidin-4-yl) 1-(benzenesulfonyl)-5-phenylindole-2-carboxylate;hydrochloride?
The IUPAC name of (1-methylpiperidin-4-yl) 1-(benzenesulfonyl)-5-phenylindole-2-carboxylate;hydrochloride (CID 44533213) is (1-methylpiperidin-4-yl) 1-(benzenesulfonyl)-5-phenylindole-2-carboxylate;hydrochloride.
What is the SMILES notation for (1-methylpiperidin-4-yl) 1-(benzenesulfonyl)-5-phenylindole-2-carboxylate;hydrochloride?
The canonical SMILES for (1-methylpiperidin-4-yl) 1-(benzenesulfonyl)-5-phenylindole-2-carboxylate;hydrochloride is CN1CCC(OC(=O)c2cc3cc(-c4ccccc4)ccc3n2S(=O)(=O)c2ccccc2)CC1.Cl.
What is the InChIKey of (1-methylpiperidin-4-yl) 1-(benzenesulfonyl)-5-phenylindole-2-carboxylate;hydrochloride?
The InChIKey is RFNZERNDMRRUPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H26N2O4S.ClH/c1-28-16-14-23(15-17-28)33-27(30)26-19-22-18-21(20-8-4-2-5-9-20)12-13-25(22)29(26)34(31,32)24-10-6-3-7-11-24;/h2-13,18-19,23H,14-17H2,1H3;1H.
What are the key properties of (1-methylpiperidin-4-yl) 1-(benzenesulfonyl)-5-phenylindole-2-carboxylate;hydrochloride?
(1-methylpiperidin-4-yl) 1-(benzenesulfonyl)-5-phenylindole-2-carboxylate;hydrochloride has a molecular weight of 511.04 g/mol, XLogP of 5.22, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpiperidin-4-yl) 1-(benzenesulfonyl)-5-phenylindole-2-carboxylate;hydrochloride is sourced from PubChem (CID 44533213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).