About 3-(dimethylamino)propyl 1-benzylsulfonyl-5-phenylindole-2-carboxylate;hydrochloride
3-(dimethylamino)propyl 1-benzylsulfonyl-5-phenylindole-2-carboxylate;hydrochloride (PubChem CID 44533233) has the molecular formula C27H29ClN2O4S
and a molecular weight of 513.06 g/mol. Its IUPAC name is 3-(dimethylamino)propyl 1-benzylsulfonyl-5-phenylindole-2-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | 3-(dimethylamino)propyl 1-benzylsulfonyl-5-phenylindole-2-carboxylate;hydrochloride |
| PubChem CID | 44533233 |
| Molecular Formula | C27H29ClN2O4S |
| Molecular Weight | 513.06 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | 3-(dimethylamino)propyl 1-benzylsulfonyl-5-phenylindole-2-carboxylate;hydrochloride |
| SMILES | CN(C)CCCOC(=O)c1cc2cc(-c3ccccc3)ccc2n1S(=O)(=O)Cc1ccccc1.Cl |
| InChI | InChI=1S/C27H28N2O4S.ClH/c1-28(2)16-9-17-33-27(30)26-19-24-18-23(22-12-7-4-8-13-22)14-15-25(24)29(26)34(31,32)20-21-10-5-3-6-11-21;/h3-8,10-15,18-19H,9,16-17,20H2,1-2H3;1H |
| InChIKey | CCDKMRJLTLVKNT-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 513.06 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(dimethylamino)propyl 1-benzylsulfonyl-5-phenylindole-2-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)propyl 1-benzylsulfonyl-5-phenylindole-2-carboxylate;hydrochloride?
The IUPAC name of 3-(dimethylamino)propyl 1-benzylsulfonyl-5-phenylindole-2-carboxylate;hydrochloride (CID 44533233) is 3-(dimethylamino)propyl 1-benzylsulfonyl-5-phenylindole-2-carboxylate;hydrochloride.
What is the SMILES notation for 3-(dimethylamino)propyl 1-benzylsulfonyl-5-phenylindole-2-carboxylate;hydrochloride?
The canonical SMILES for 3-(dimethylamino)propyl 1-benzylsulfonyl-5-phenylindole-2-carboxylate;hydrochloride is CN(C)CCCOC(=O)c1cc2cc(-c3ccccc3)ccc2n1S(=O)(=O)Cc1ccccc1.Cl.
What is the InChIKey of 3-(dimethylamino)propyl 1-benzylsulfonyl-5-phenylindole-2-carboxylate;hydrochloride?
The InChIKey is CCDKMRJLTLVKNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H28N2O4S.ClH/c1-28(2)16-9-17-33-27(30)26-19-24-18-23(22-12-7-4-8-13-22)14-15-25(24)29(26)34(31,32)20-21-10-5-3-6-11-21;/h3-8,10-15,18-19H,9,16-17,20H2,1-2H3;1H.
What are the key properties of 3-(dimethylamino)propyl 1-benzylsulfonyl-5-phenylindole-2-carboxylate;hydrochloride?
3-(dimethylamino)propyl 1-benzylsulfonyl-5-phenylindole-2-carboxylate;hydrochloride has a molecular weight of 513.06 g/mol, XLogP of 5.22, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)propyl 1-benzylsulfonyl-5-phenylindole-2-carboxylate;hydrochloride is sourced from PubChem (CID 44533233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).