C28H44ClNO4S — CID 44533317
[(1S,2R,3S,4S,6R,7R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[[(3R,4S)-1-azabicyclo[2.2.1]heptan-3-yl]sulfanyl]acetate;hydrochloride (PubChem CID 44533317) has the molecular formula C28H44ClNO4S and a molecular weight of 526.18 g/mol. Its IUPAC name is [(1S,2R,3S,4S,6R,7R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[[(3R,4S)-1-azabicyclo[2.2.1]heptan-3-yl]sulfanyl]acetate;hydrochloride.
| Compound Name | [(1S,2R,3S,4S,6R,7R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[[(3R,4S)-1-azabicyclo[2.2.1]heptan-3-yl]sulfanyl]acetate;hydrochloride |
|---|---|
| PubChem CID | 44533317 |
| Molecular Formula | C28H44ClNO4S |
| Molecular Weight | 526.18 g/mol |
| Exact Mass | 525.27 |
| IUPAC Name | [(1S,2R,3S,4S,6R,7R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[[(3R,4S)-1-azabicyclo[2.2.1]heptan-3-yl]sulfanyl]acetate;hydrochloride |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)CS[C@H]2CN3CC[C@H]2C3)[C@@]2(C)C3C(=O)CC[C@@]3(CC[C@H]2C)[C@@H](C)[C@@H]1O.Cl |
| InChI | InChI=1S/C28H43NO4S.ClH/c1-6-26(4)13-22(33-23(31)16-34-21-15-29-12-9-19(21)14-29)27(5)17(2)7-10-28(18(3)25(26)32)11-8-20(30)24(27)28;/h6,17-19,21-22,24-25,32H,1,7-16H2,2-5H3;1H/t17-,18+,19+,21+,22-,24?,25+,26-,27+,28+;/m1./s1 |
| InChIKey | VGUHJVHWNRCMHN-DZKOFFNISA-N |
| XLogP | 4.75 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.18 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|