C26H39N3O — CID 44533339
N-[2-[(3R,4R)-3-ethenyl-1-heptylpiperidin-4-yl]ethyl]-6-methoxyquinolin-4-amine (PubChem CID 44533339) has the molecular formula C26H39N3O and a molecular weight of 409.62 g/mol. Its IUPAC name is N-[2-[(3R,4R)-3-ethenyl-1-heptylpiperidin-4-yl]ethyl]-6-methoxyquinolin-4-amine.
| Compound Name | N-[2-[(3R,4R)-3-ethenyl-1-heptylpiperidin-4-yl]ethyl]-6-methoxyquinolin-4-amine |
|---|---|
| PubChem CID | 44533339 |
| Molecular Formula | C26H39N3O |
| Molecular Weight | 409.62 g/mol |
| Exact Mass | 409.31 |
| IUPAC Name | N-[2-[(3R,4R)-3-ethenyl-1-heptylpiperidin-4-yl]ethyl]-6-methoxyquinolin-4-amine |
| SMILES | C=C[C@H]1CN(CCCCCCC)CC[C@H]1CCNc1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C26H39N3O/c1-4-6-7-8-9-17-29-18-14-22(21(5-2)20-29)12-15-27-26-13-16-28-25-11-10-23(30-3)19-24(25)26/h5,10-11,13,16,19,21-22H,2,4,6-9,12,14-15,17-18,20H2,1,3H3,(H,27,28)/t21-,22+/m0/s1 |
| InChIKey | FCQGHCLPYHCBEO-FCHUYYIVSA-N |
| XLogP | 6.14 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.62 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|