C29H32N8O2 — CID 44533372
6-N-[2-(3,4-dimethoxyphenyl)ethyl]-4-N-[2-(1H-imidazol-5-yl)ethyl]-2-N-(naphthalen-1-ylmethyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 44533372) has the molecular formula C29H32N8O2 and a molecular weight of 524.63 g/mol. Its IUPAC name is 6-N-[2-(3,4-dimethoxyphenyl)ethyl]-4-N-[2-(1H-imidazol-5-yl)ethyl]-2-N-(naphthalen-1-ylmethyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-[2-(3,4-dimethoxyphenyl)ethyl]-4-N-[2-(1H-imidazol-5-yl)ethyl]-2-N-(naphthalen-1-ylmethyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 44533372 |
| Molecular Formula | C29H32N8O2 |
| Molecular Weight | 524.63 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | 6-N-[2-(3,4-dimethoxyphenyl)ethyl]-4-N-[2-(1H-imidazol-5-yl)ethyl]-2-N-(naphthalen-1-ylmethyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | COc1ccc(CCNc2nc(NCCc3cnc[nH]3)nc(NCc3cccc4ccccc34)n2)cc1OC |
| InChI | InChI=1S/C29H32N8O2/c1-38-25-11-10-20(16-26(25)39-2)12-14-31-27-35-28(32-15-13-23-18-30-19-34-23)37-29(36-27)33-17-22-8-5-7-21-6-3-4-9-24(21)22/h3-11,16,18-19H,12-15,17H2,1-2H3,(H,30,34)(H3,31,32,33,35,36,37) |
| InChIKey | ZSWHUTXAMULWDK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 121.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.63 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |