C29H43N3O5 — CID 44533397
N-[2-[(3R,4S)-3-ethenyl-1-heptylpiperidin-4-yl]ethyl]-6-methoxy-N-methylquinolin-4-amine;oxalic acid (PubChem CID 44533397) has the molecular formula C29H43N3O5 and a molecular weight of 513.68 g/mol. Its IUPAC name is N-[2-[(3R,4S)-3-ethenyl-1-heptylpiperidin-4-yl]ethyl]-6-methoxy-N-methylquinolin-4-amine;oxalic acid.
| Compound Name | N-[2-[(3R,4S)-3-ethenyl-1-heptylpiperidin-4-yl]ethyl]-6-methoxy-N-methylquinolin-4-amine;oxalic acid |
|---|---|
| PubChem CID | 44533397 |
| Molecular Formula | C29H43N3O5 |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.32 |
| IUPAC Name | N-[2-[(3R,4S)-3-ethenyl-1-heptylpiperidin-4-yl]ethyl]-6-methoxy-N-methylquinolin-4-amine;oxalic acid |
| SMILES | C=C[C@H]1CN(CCCCCCC)CC[C@H]1CCN(C)c1ccnc2ccc(OC)cc12.O=C(O)C(=O)O |
| InChI | InChI=1S/C27H41N3O.C2H2O4/c1-5-7-8-9-10-17-30-19-15-23(22(6-2)21-30)14-18-29(3)27-13-16-28-26-12-11-24(31-4)20-25(26)27;3-1(4)2(5)6/h6,11-13,16,20,22-23H,2,5,7-10,14-15,17-19,21H2,1,3-4H3;(H,3,4)(H,5,6)/t22-,23+;/m0./s1 |
| InChIKey | XPOCIRCOGAZCGB-PEADMDKFSA-N |
| XLogP | 5.32 |
| TPSA | 103.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|