C29H45N3O5 — CID 44533400
2-[(3R,4R)-1-heptyl-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]ethanamine;oxalic acid (PubChem CID 44533400) has the molecular formula C29H45N3O5 and a molecular weight of 515.70 g/mol. Its IUPAC name is 2-[(3R,4R)-1-heptyl-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]ethanamine;oxalic acid.
| Compound Name | 2-[(3R,4R)-1-heptyl-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]ethanamine;oxalic acid |
|---|---|
| PubChem CID | 44533400 |
| Molecular Formula | C29H45N3O5 |
| Molecular Weight | 515.70 g/mol |
| Exact Mass | 515.34 |
| IUPAC Name | 2-[(3R,4R)-1-heptyl-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]ethanamine;oxalic acid |
| SMILES | CCCCCCCN1CC[C@@H](CCCc2ccnc3ccc(OC)cc23)[C@@H](CCN)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C27H43N3O.C2H2O4/c1-3-4-5-6-7-18-30-19-15-22(24(21-30)13-16-28)9-8-10-23-14-17-29-27-12-11-25(31-2)20-26(23)27;3-1(4)2(5)6/h11-12,14,17,20,22,24H,3-10,13,15-16,18-19,21,28H2,1-2H3;(H,3,4)(H,5,6)/t22-,24+;/m1./s1 |
| InChIKey | NNJRIQBWXRJQDB-UTSIGBCTSA-N |
| XLogP | 4.98 |
| TPSA | 125.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.70 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|