C21H32N2O5S — CID 44533421
ethyl 1-[4-(dipropylsulfamoyl)benzoyl]piperidine-4-carboxylate (PubChem CID 44533421) has the molecular formula C21H32N2O5S and a molecular weight of 424.56 g/mol. Its IUPAC name is ethyl 1-[4-(dipropylsulfamoyl)benzoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-(dipropylsulfamoyl)benzoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 44533421 |
| Molecular Formula | C21H32N2O5S |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | ethyl 1-[4-(dipropylsulfamoyl)benzoyl]piperidine-4-carboxylate |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(C(=O)N2CCC(C(=O)OCC)CC2)cc1 |
| InChI | InChI=1S/C21H32N2O5S/c1-4-13-23(14-5-2)29(26,27)19-9-7-17(8-10-19)20(24)22-15-11-18(12-16-22)21(25)28-6-3/h7-10,18H,4-6,11-16H2,1-3H3 |
| InChIKey | DUQUSCOKKBTAOK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |