About 7-chloro-2-[3-[(3,4-dichlorophenyl)methylamino]propylamino]-1H-quinolin-4-one
7-chloro-2-[3-[(3,4-dichlorophenyl)methylamino]propylamino]-1H-quinolin-4-one (PubChem CID 44533533) has the molecular formula C19H18Cl3N3O
and a molecular weight of 410.73 g/mol. Its IUPAC name is 7-chloro-2-[3-[(3,4-dichlorophenyl)methylamino]propylamino]-1H-quinolin-4-one.
Molecular Properties
| Compound Name | 7-chloro-2-[3-[(3,4-dichlorophenyl)methylamino]propylamino]-1H-quinolin-4-one |
| PubChem CID | 44533533 |
| Molecular Formula | C19H18Cl3N3O |
| Molecular Weight | 410.73 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | 7-chloro-2-[3-[(3,4-dichlorophenyl)methylamino]propylamino]-1H-quinolin-4-one |
| SMILES | O=c1cc(NCCCNCc2ccc(Cl)c(Cl)c2)[nH]c2cc(Cl)ccc12 |
| InChI | InChI=1S/C19H18Cl3N3O/c20-13-3-4-14-17(9-13)25-19(10-18(14)26)24-7-1-6-23-11-12-2-5-15(21)16(22)8-12/h2-5,8-10,23H,1,6-7,11H2,(H2,24,25,26) |
| InChIKey | WUNKWVVOPCYTQD-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.73 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-2-[3-[(3,4-dichlorophenyl)methylamino]propylamino]-1H-quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-2-[3-[(3,4-dichlorophenyl)methylamino]propylamino]-1H-quinolin-4-one?
The IUPAC name of 7-chloro-2-[3-[(3,4-dichlorophenyl)methylamino]propylamino]-1H-quinolin-4-one (CID 44533533) is 7-chloro-2-[3-[(3,4-dichlorophenyl)methylamino]propylamino]-1H-quinolin-4-one.
What is the SMILES notation for 7-chloro-2-[3-[(3,4-dichlorophenyl)methylamino]propylamino]-1H-quinolin-4-one?
The canonical SMILES for 7-chloro-2-[3-[(3,4-dichlorophenyl)methylamino]propylamino]-1H-quinolin-4-one is O=c1cc(NCCCNCc2ccc(Cl)c(Cl)c2)[nH]c2cc(Cl)ccc12.
What is the InChIKey of 7-chloro-2-[3-[(3,4-dichlorophenyl)methylamino]propylamino]-1H-quinolin-4-one?
The InChIKey is WUNKWVVOPCYTQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18Cl3N3O/c20-13-3-4-14-17(9-13)25-19(10-18(14)26)24-7-1-6-23-11-12-2-5-15(21)16(22)8-12/h2-5,8-10,23H,1,6-7,11H2,(H2,24,25,26).
What are the key properties of 7-chloro-2-[3-[(3,4-dichlorophenyl)methylamino]propylamino]-1H-quinolin-4-one?
7-chloro-2-[3-[(3,4-dichlorophenyl)methylamino]propylamino]-1H-quinolin-4-one has a molecular weight of 410.73 g/mol, XLogP of 5.08, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-2-[3-[(3,4-dichlorophenyl)methylamino]propylamino]-1H-quinolin-4-one is sourced from PubChem (CID 44533533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).