C42H41Cl2N5O5 — CID 44533547
(2Z,4E)-N-[3-[4-[3-[2-(3-benzoylanilino)-2-oxoethoxy]phenyl]piperazin-1-yl]propyl]-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxypenta-2,4-dienamide (PubChem CID 44533547) has the molecular formula C42H41Cl2N5O5 and a molecular weight of 766.73 g/mol. Its IUPAC name is (2Z,4E)-N-[3-[4-[3-[2-(3-benzoylanilino)-2-oxoethoxy]phenyl]piperazin-1-yl]propyl]-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxypenta-2,4-dienamide.
| Compound Name | (2Z,4E)-N-[3-[4-[3-[2-(3-benzoylanilino)-2-oxoethoxy]phenyl]piperazin-1-yl]propyl]-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxypenta-2,4-dienamide |
|---|---|
| PubChem CID | 44533547 |
| Molecular Formula | C42H41Cl2N5O5 |
| Molecular Weight | 766.73 g/mol |
| Exact Mass | 765.25 |
| IUPAC Name | (2Z,4E)-N-[3-[4-[3-[2-(3-benzoylanilino)-2-oxoethoxy]phenyl]piperazin-1-yl]propyl]-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxypenta-2,4-dienamide |
| SMILES | CO/C(=C\C=C\c1cc2cc(Cl)c(Cl)cc2[nH]1)C(=O)NCCCN1CCN(c2cccc(OCC(=O)Nc3cccc(C(=O)c4ccccc4)c3)c2)CC1 |
| InChI | InChI=1S/C42H41Cl2N5O5/c1-53-39(16-6-13-32-24-31-25-36(43)37(44)27-38(31)46-32)42(52)45-17-8-18-48-19-21-49(22-20-48)34-14-7-15-35(26-34)54-28-40(50)47-33-12-5-11-30(23-33)41(51)29-9-3-2-4-10-29/h2-7,9-16,23-27,46H,8,17-22,28H2,1H3,(H,45,52)(H,47,50)/b13-6+,39-16- |
| InChIKey | FSADQNMMWTXQIP-WBAVYHETSA-N |
| XLogP | 7.60 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.73 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|