C25H34Cl2N2O — CID 44533601
(2E,4E)-N-[5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)pentyl]-5-(3,4-dichlorophenyl)penta-2,4-dienamide (PubChem CID 44533601) has the molecular formula C25H34Cl2N2O and a molecular weight of 449.47 g/mol. Its IUPAC name is (2E,4E)-N-[5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)pentyl]-5-(3,4-dichlorophenyl)penta-2,4-dienamide.
| Compound Name | (2E,4E)-N-[5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)pentyl]-5-(3,4-dichlorophenyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 44533601 |
| Molecular Formula | C25H34Cl2N2O |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | (2E,4E)-N-[5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)pentyl]-5-(3,4-dichlorophenyl)penta-2,4-dienamide |
| SMILES | O=C(/C=C/C=C/c1ccc(Cl)c(Cl)c1)NCCCCCN1CCCC2CCCCC21 |
| InChI | InChI=1S/C25H34Cl2N2O/c26-22-15-14-20(19-23(22)27)9-2-5-13-25(30)28-16-6-1-7-17-29-18-8-11-21-10-3-4-12-24(21)29/h2,5,9,13-15,19,21,24H,1,3-4,6-8,10-12,16-18H2,(H,28,30)/b9-2+,13-5+ |
| InChIKey | OVPPARVKZVMJMM-GLPOJRDZSA-N |
| XLogP | 6.50 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|