C30H37Cl2F3N4O2 — CID 44533646
(E)-3-(3,4-dichlorophenyl)-N-[5-[3-[3-[[4-(trifluoromethyl)phenyl]carbamoylamino]propyl]piperidin-1-yl]pentyl]prop-2-enamide (PubChem CID 44533646) has the molecular formula C30H37Cl2F3N4O2 and a molecular weight of 613.55 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[5-[3-[3-[[4-(trifluoromethyl)phenyl]carbamoylamino]propyl]piperidin-1-yl]pentyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[5-[3-[3-[[4-(trifluoromethyl)phenyl]carbamoylamino]propyl]piperidin-1-yl]pentyl]prop-2-enamide |
|---|---|
| PubChem CID | 44533646 |
| Molecular Formula | C30H37Cl2F3N4O2 |
| Molecular Weight | 613.55 g/mol |
| Exact Mass | 612.22 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[5-[3-[3-[[4-(trifluoromethyl)phenyl]carbamoylamino]propyl]piperidin-1-yl]pentyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)NCCCCCN1CCCC(CCCNC(=O)Nc2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C30H37Cl2F3N4O2/c31-26-14-8-22(20-27(26)32)9-15-28(40)36-16-2-1-3-18-39-19-5-7-23(21-39)6-4-17-37-29(41)38-25-12-10-24(11-13-25)30(33,34)35/h8-15,20,23H,1-7,16-19,21H2,(H,36,40)(H2,37,38,41)/b15-9+ |
| InChIKey | JYXSCEONQOQFOF-OQLLNIDSSA-N |
| XLogP | 7.63 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.55 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|