C28H33Cl2F3N4O2 — CID 44533650
(E)-3-(3,4-dichlorophenyl)-N-[5-[3-[[[4-(trifluoromethyl)phenyl]carbamoylamino]methyl]piperidin-1-yl]pentyl]prop-2-enamide (PubChem CID 44533650) has the molecular formula C28H33Cl2F3N4O2 and a molecular weight of 585.50 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[5-[3-[[[4-(trifluoromethyl)phenyl]carbamoylamino]methyl]piperidin-1-yl]pentyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[5-[3-[[[4-(trifluoromethyl)phenyl]carbamoylamino]methyl]piperidin-1-yl]pentyl]prop-2-enamide |
|---|---|
| PubChem CID | 44533650 |
| Molecular Formula | C28H33Cl2F3N4O2 |
| Molecular Weight | 585.50 g/mol |
| Exact Mass | 584.19 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[5-[3-[[[4-(trifluoromethyl)phenyl]carbamoylamino]methyl]piperidin-1-yl]pentyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)NCCCCCN1CCCC(CNC(=O)Nc2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C28H33Cl2F3N4O2/c29-24-12-6-20(17-25(24)30)7-13-26(38)34-14-2-1-3-15-37-16-4-5-21(19-37)18-35-27(39)36-23-10-8-22(9-11-23)28(31,32)33/h6-13,17,21H,1-5,14-16,18-19H2,(H,34,38)(H2,35,36,39)/b13-7+ |
| InChIKey | BXUUZIADYSJDFA-NTUHNPAUSA-N |
| XLogP | 6.85 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.50 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|