C29H38Cl2N4O2 — CID 44533652
(E)-3-(3,4-dichlorophenyl)-N-[5-[4-[methyl(2-phenylethylcarbamoyl)amino]piperidin-1-yl]pentyl]prop-2-enamide (PubChem CID 44533652) has the molecular formula C29H38Cl2N4O2 and a molecular weight of 545.56 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[5-[4-[methyl(2-phenylethylcarbamoyl)amino]piperidin-1-yl]pentyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[5-[4-[methyl(2-phenylethylcarbamoyl)amino]piperidin-1-yl]pentyl]prop-2-enamide |
|---|---|
| PubChem CID | 44533652 |
| Molecular Formula | C29H38Cl2N4O2 |
| Molecular Weight | 545.56 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[5-[4-[methyl(2-phenylethylcarbamoyl)amino]piperidin-1-yl]pentyl]prop-2-enamide |
| SMILES | CN(C(=O)NCCc1ccccc1)C1CCN(CCCCCNC(=O)/C=C/c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C29H38Cl2N4O2/c1-34(29(37)33-18-14-23-8-4-2-5-9-23)25-15-20-35(21-16-25)19-7-3-6-17-32-28(36)13-11-24-10-12-26(30)27(31)22-24/h2,4-5,8-13,22,25H,3,6-7,14-21H2,1H3,(H,32,36)(H,33,37)/b13-11+ |
| InChIKey | SSPBIPNCZDHDGN-ACCUITESSA-N |
| XLogP | 5.64 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.56 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|