C28H27N7O2S — CID 44533696
1-[3-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]phenyl]-3-[2-(5-phenylmethoxy-1H-indol-3-yl)ethyl]urea (PubChem CID 44533696) has the molecular formula C28H27N7O2S and a molecular weight of 525.64 g/mol. Its IUPAC name is 1-[3-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]phenyl]-3-[2-(5-phenylmethoxy-1H-indol-3-yl)ethyl]urea.
| Compound Name | 1-[3-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]phenyl]-3-[2-(5-phenylmethoxy-1H-indol-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 44533696 |
| Molecular Formula | C28H27N7O2S |
| Molecular Weight | 525.64 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | 1-[3-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]phenyl]-3-[2-(5-phenylmethoxy-1H-indol-3-yl)ethyl]urea |
| SMILES | NC(N)=Nc1nc(-c2cccc(NC(=O)NCCc3c[nH]c4ccc(OCc5ccccc5)cc34)c2)cs1 |
| InChI | InChI=1S/C28H27N7O2S/c29-26(30)35-28-34-25(17-38-28)19-7-4-8-21(13-19)33-27(36)31-12-11-20-15-32-24-10-9-22(14-23(20)24)37-16-18-5-2-1-3-6-18/h1-10,13-15,17,32H,11-12,16H2,(H2,31,33,36)(H4,29,30,34,35) |
| InChIKey | OXONONGBRRFEES-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 143.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.64 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|