C37H47F3N2O4 — CID 44533699
[(2S)-1-[(3R,4S)-3-ethenyl-1-heptylpiperidin-4-yl]-3-(6-methoxyquinolin-4-yl)propan-2-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 44533699) has the molecular formula C37H47F3N2O4 and a molecular weight of 640.79 g/mol. Its IUPAC name is [(2S)-1-[(3R,4S)-3-ethenyl-1-heptylpiperidin-4-yl]-3-(6-methoxyquinolin-4-yl)propan-2-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(2S)-1-[(3R,4S)-3-ethenyl-1-heptylpiperidin-4-yl]-3-(6-methoxyquinolin-4-yl)propan-2-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 44533699 |
| Molecular Formula | C37H47F3N2O4 |
| Molecular Weight | 640.79 g/mol |
| Exact Mass | 640.35 |
| IUPAC Name | [(2S)-1-[(3R,4S)-3-ethenyl-1-heptylpiperidin-4-yl]-3-(6-methoxyquinolin-4-yl)propan-2-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | C=C[C@H]1CN(CCCCCCC)CC[C@H]1C[C@@H](Cc1ccnc2ccc(OC)cc12)OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C37H47F3N2O4/c1-5-7-8-9-13-21-42-22-19-28(27(6-2)26-42)23-32(24-29-18-20-41-34-17-16-31(44-3)25-33(29)34)46-35(43)36(45-4,37(38,39)40)30-14-11-10-12-15-30/h6,10-12,14-18,20,25,27-28,32H,2,5,7-9,13,19,21-24,26H2,1,3-4H3/t27-,28-,32-,36+/m0/s1 |
| InChIKey | ZMBZLVQBAXNAHS-IUXJBAHRSA-N |
| XLogP | 8.29 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.79 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|